C23H27NO — CID 155679773
(8S,10R,13S,14S)-10,13-dimethyl-3-(1H-pyrrol-2-yl)-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-one (PubChem CID 155679773) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is (8S,10R,13S,14S)-10,13-dimethyl-3-(1H-pyrrol-2-yl)-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8S,10R,13S,14S)-10,13-dimethyl-3-(1H-pyrrol-2-yl)-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 155679773 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (8S,10R,13S,14S)-10,13-dimethyl-3-(1H-pyrrol-2-yl)-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC(c3ccc[nH]3)=CC1=CC[C@@H]1C2=CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C23H27NO/c1-22-11-9-15(20-4-3-13-24-20)14-16(22)5-6-17-18-7-8-21(25)23(18,2)12-10-19(17)22/h3-5,10,13-14,17-18,24H,6-9,11-12H2,1-2H3/t17-,18-,22-,23-/m0/s1 |
| InChIKey | FUZDTEUOYGFOMY-PTRHGPIFSA-N |
| XLogP | 5.46 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|