C28H42ClNO4Si — CID 70387644
(8S,10R,13S,14S,17R)-17-[chloromethyl-di(propan-2-yloxy)silyl]oxy-3-methoxy-10,13-dimethyl-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 70387644) has the molecular formula C28H42ClNO4Si and a molecular weight of 520.19 g/mol. Its IUPAC name is (8S,10R,13S,14S,17R)-17-[chloromethyl-di(propan-2-yloxy)silyl]oxy-3-methoxy-10,13-dimethyl-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (8S,10R,13S,14S,17R)-17-[chloromethyl-di(propan-2-yloxy)silyl]oxy-3-methoxy-10,13-dimethyl-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 70387644 |
| Molecular Formula | C28H42ClNO4Si |
| Molecular Weight | 520.19 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | (8S,10R,13S,14S,17R)-17-[chloromethyl-di(propan-2-yloxy)silyl]oxy-3-methoxy-10,13-dimethyl-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | COC1=CC2=CC[C@@H]3C(=CC[C@@]4(C)[C@H]3CC[C@@]4(C#N)O[Si](CCl)(OC(C)C)OC(C)C)[C@@]2(C)CC1 |
| InChI | InChI=1S/C28H42ClNO4Si/c1-19(2)32-35(18-29,33-20(3)4)34-28(17-30)15-12-25-23-9-8-21-16-22(31-7)10-13-26(21,5)24(23)11-14-27(25,28)6/h8,11,16,19-20,23,25H,9-10,12-15,18H2,1-7H3/t23-,25+,26+,27+,28+/m1/s1 |
| InChIKey | MFPQFRSIGFQFET-OFGRGEMESA-N |
| XLogP | 6.86 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.19 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|