C24H36BrNO2Si — CID 14697610
(8R,9S,10R,13S,14S,17R)-17-[bromomethyl(dimethyl)silyl]oxy-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 14697610) has the molecular formula C24H36BrNO2Si and a molecular weight of 478.55 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-17-[bromomethyl(dimethyl)silyl]oxy-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (8R,9S,10R,13S,14S,17R)-17-[bromomethyl(dimethyl)silyl]oxy-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 14697610 |
| Molecular Formula | C24H36BrNO2Si |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-[bromomethyl(dimethyl)silyl]oxy-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | COC1=CC2=CC[C@@H]3[C@H](CC[C@@]4(C)[C@H]3CC[C@@]4(C#N)O[Si](C)(C)CBr)[C@@]2(C)CC1 |
| InChI | InChI=1S/C24H36BrNO2Si/c1-22-11-8-18(27-3)14-17(22)6-7-19-20(22)9-12-23(2)21(19)10-13-24(23,15-26)28-29(4,5)16-25/h6,14,19-21H,7-13,16H2,1-5H3/t19-,20+,21+,22+,23+,24+/m1/s1 |
| InChIKey | RWXNHQYQRPSNJU-CKOZHMEPSA-N |
| XLogP | 6.51 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|