C24H36ClNO3Si — CID 67894741
(8S,9S,10R,11S,13S,14S,17R)-17-[chloromethyl(dimethyl)silyl]oxy-11-hydroxy-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 67894741) has the molecular formula C24H36ClNO3Si and a molecular weight of 450.10 g/mol. Its IUPAC name is (8S,9S,10R,11S,13S,14S,17R)-17-[chloromethyl(dimethyl)silyl]oxy-11-hydroxy-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (8S,9S,10R,11S,13S,14S,17R)-17-[chloromethyl(dimethyl)silyl]oxy-11-hydroxy-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 67894741 |
| Molecular Formula | C24H36ClNO3Si |
| Molecular Weight | 450.10 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (8S,9S,10R,11S,13S,14S,17R)-17-[chloromethyl(dimethyl)silyl]oxy-11-hydroxy-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | COC1=CC2=CC[C@@H]3[C@H]([C@@H](O)C[C@@]4(C)[C@H]3CC[C@@]4(C#N)O[Si](C)(C)CCl)[C@@]2(C)CC1 |
| InChI | InChI=1S/C24H36ClNO3Si/c1-22-10-8-17(28-3)12-16(22)6-7-18-19-9-11-24(14-26,29-30(4,5)15-25)23(19,2)13-20(27)21(18)22/h6,12,18-21,27H,7-11,13,15H2,1-5H3/t18-,19-,20-,21+,22-,23-,24-/m0/s1 |
| InChIKey | CEMSKUCEBADQSW-WQCLFZALSA-N |
| XLogP | 5.32 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.10 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|