C23H34O2S — CID 87498601
(10R,13S)-3-methoxy-10,13-dimethyl-15-(2-sulfanylpropan-2-yl)-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (PubChem CID 87498601) has the molecular formula C23H34O2S and a molecular weight of 374.59 g/mol. Its IUPAC name is (10R,13S)-3-methoxy-10,13-dimethyl-15-(2-sulfanylpropan-2-yl)-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (10R,13S)-3-methoxy-10,13-dimethyl-15-(2-sulfanylpropan-2-yl)-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 87498601 |
| Molecular Formula | C23H34O2S |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (10R,13S)-3-methoxy-10,13-dimethyl-15-(2-sulfanylpropan-2-yl)-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| SMILES | COC1=CC2=CCC3C(CC[C@]4(C)C(=O)CC(C(C)(C)S)C34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C23H34O2S/c1-21(2,26)18-13-19(24)23(4)11-9-17-16(20(18)23)7-6-14-12-15(25-5)8-10-22(14,17)3/h6,12,16-18,20,26H,7-11,13H2,1-5H3/t16?,17?,18?,20?,22-,23+/m0/s1 |
| InChIKey | VVLJJWBZKRHZCT-GCNGWRMBSA-N |
| XLogP | 5.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|