C21H31FO2 — CID 67781204
(8S,9S,10R,11S,13S,14S,17S)-11-fluoro-3-methoxy-10,13,17-trimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 67781204) has the molecular formula C21H31FO2 and a molecular weight of 334.48 g/mol. Its IUPAC name is (8S,9S,10R,11S,13S,14S,17S)-11-fluoro-3-methoxy-10,13,17-trimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,9S,10R,11S,13S,14S,17S)-11-fluoro-3-methoxy-10,13,17-trimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 67781204 |
| Molecular Formula | C21H31FO2 |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (8S,9S,10R,11S,13S,14S,17S)-11-fluoro-3-methoxy-10,13,17-trimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | COC1=CC2=CC[C@@H]3[C@H]([C@@H](F)C[C@@]4(C)[C@H]3CC[C@]4(C)O)[C@@]2(C)CC1 |
| InChI | InChI=1S/C21H31FO2/c1-19-9-7-14(24-4)11-13(19)5-6-15-16-8-10-21(3,23)20(16,2)12-17(22)18(15)19/h5,11,15-18,23H,6-10,12H2,1-4H3/t15-,16-,17-,18+,19-,20-,21-/m0/s1 |
| InChIKey | ZNDFSRUURCGSFO-UJPCIWJBSA-N |
| XLogP | 4.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |