C22H31NO4 — CID 91471130
[(10R,11S,13S)-3-methoxy-10,13-dimethyl-17-nitroso-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate (PubChem CID 91471130) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is [(10R,11S,13S)-3-methoxy-10,13-dimethyl-17-nitroso-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate.
| Compound Name | [(10R,11S,13S)-3-methoxy-10,13-dimethyl-17-nitroso-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate |
|---|---|
| PubChem CID | 91471130 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | [(10R,11S,13S)-3-methoxy-10,13-dimethyl-17-nitroso-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate |
| SMILES | COC1=CC2=CCC3C4CCC(N=O)[C@@]4(C)CC(OC(C)=O)C3[C@@]2(C)CC1 |
| InChI | InChI=1S/C22H31NO4/c1-13(24)27-18-12-22(3)17(7-8-19(22)23-25)16-6-5-14-11-15(26-4)9-10-21(14,2)20(16)18/h5,11,16-20H,6-10,12H2,1-4H3/t16?,17?,18?,19?,20?,21-,22-/m0/s1 |
| InChIKey | IPMBPBSUZKEXTQ-MAFYVXJPSA-N |
| XLogP | 4.77 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |