C24H35NO4 — CID 123907506
[17-(dimethylcarbamoyl)-11-hydroxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 123907506) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is [17-(dimethylcarbamoyl)-11-hydroxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [17-(dimethylcarbamoyl)-11-hydroxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 123907506 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | [17-(dimethylcarbamoyl)-11-hydroxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1=CC2=CCC3C(C(O)CC4(C)C(C(=O)N(C)C)CCC34)C2(C)CC1 |
| InChI | InChI=1S/C24H35NO4/c1-14(26)29-16-10-11-23(2)15(12-16)6-7-17-18-8-9-19(22(28)25(4)5)24(18,3)13-20(27)21(17)23/h6,12,17-21,27H,7-11,13H2,1-5H3 |
| InChIKey | JSGAQTYXHQLIFD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |