C21H31FO2 — CID 123973987
1-(3-fluoro-11-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone (PubChem CID 123973987) has the molecular formula C21H31FO2 and a molecular weight of 334.48 g/mol. Its IUPAC name is 1-(3-fluoro-11-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone.
| Compound Name | 1-(3-fluoro-11-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
|---|---|
| PubChem CID | 123973987 |
| Molecular Formula | C21H31FO2 |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1-(3-fluoro-11-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
| SMILES | CC(=O)C1CCC2C3CC=C4CC(F)CCC4(C)C3C(O)CC12C |
| InChI | InChI=1S/C21H31FO2/c1-12(23)16-6-7-17-15-5-4-13-10-14(22)8-9-20(13,2)19(15)18(24)11-21(16,17)3/h4,14-19,24H,5-11H2,1-3H3 |
| InChIKey | LGUILEZBNRYAQG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|