C21H31ClO2 — CID 125034654
1-[(3R,8S,9R,10R,11R,13R,14R,17R)-3-chloro-11-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 125034654) has the molecular formula C21H31ClO2 and a molecular weight of 350.93 g/mol. Its IUPAC name is 1-[(3R,8S,9R,10R,11R,13R,14R,17R)-3-chloro-11-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3R,8S,9R,10R,11R,13R,14R,17R)-3-chloro-11-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 125034654 |
| Molecular Formula | C21H31ClO2 |
| Molecular Weight | 350.93 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-[(3R,8S,9R,10R,11R,13R,14R,17R)-3-chloro-11-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CC[C@@H]2[C@@H]3CC=C4C[C@H](Cl)CC[C@]4(C)[C@@H]3[C@H](O)C[C@]21C |
| InChI | InChI=1S/C21H31ClO2/c1-12(23)16-6-7-17-15-5-4-13-10-14(22)8-9-20(13,2)19(15)18(24)11-21(16,17)3/h4,14-19,24H,5-11H2,1-3H3/t14-,15+,16+,17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | KUVKZKUBSUKKMO-ZENBKHFWSA-N |
| XLogP | 4.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.93 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|