C20H28O3 — CID 134424968
1-(15-hydroxy-5-methyl-2-oxapentacyclo[8.7.1.01,13.03,18.05,9]octadec-12-en-6-yl)ethanone (PubChem CID 134424968) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 1-(15-hydroxy-5-methyl-2-oxapentacyclo[8.7.1.01,13.03,18.05,9]octadec-12-en-6-yl)ethanone.
| Compound Name | 1-(15-hydroxy-5-methyl-2-oxapentacyclo[8.7.1.01,13.03,18.05,9]octadec-12-en-6-yl)ethanone |
|---|---|
| PubChem CID | 134424968 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 1-(15-hydroxy-5-methyl-2-oxapentacyclo[8.7.1.01,13.03,18.05,9]octadec-12-en-6-yl)ethanone |
| SMILES | CC(=O)C1CCC2C3CC=C4CC(O)CCC45OC(CC12C)C35 |
| InChI | InChI=1S/C20H28O3/c1-11(21)15-5-6-16-14-4-3-12-9-13(22)7-8-20(12)18(14)17(23-20)10-19(15,16)2/h3,13-18,22H,4-10H2,1-2H3 |
| InChIKey | CAXUJEKTMZRGLP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|