C21H30O3 — CID 123610169
1-(15-hydroxy-3,5-dimethyl-2-oxapentacyclo[8.7.1.01,13.03,18.05,9]octadec-12-en-6-yl)ethanone (PubChem CID 123610169) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-(15-hydroxy-3,5-dimethyl-2-oxapentacyclo[8.7.1.01,13.03,18.05,9]octadec-12-en-6-yl)ethanone.
| Compound Name | 1-(15-hydroxy-3,5-dimethyl-2-oxapentacyclo[8.7.1.01,13.03,18.05,9]octadec-12-en-6-yl)ethanone |
|---|---|
| PubChem CID | 123610169 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-(15-hydroxy-3,5-dimethyl-2-oxapentacyclo[8.7.1.01,13.03,18.05,9]octadec-12-en-6-yl)ethanone |
| SMILES | CC(=O)C1CCC2C3CC=C4CC(O)CCC45OC(C)(CC12C)C35 |
| InChI | InChI=1S/C21H30O3/c1-12(22)16-6-7-17-15-5-4-13-10-14(23)8-9-21(13)18(15)20(3,24-21)11-19(16,17)2/h4,14-18,23H,5-11H2,1-3H3 |
| InChIKey | QUVUEPLJAXXDPW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|