C22H28O — CID 57145288
(8R,9S,10R,13S,14S)-17-ethynyl-3-methoxy-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 57145288) has the molecular formula C22H28O and a molecular weight of 308.47 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-17-ethynyl-3-methoxy-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8R,9S,10R,13S,14S)-17-ethynyl-3-methoxy-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 57145288 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | (8R,9S,10R,13S,14S)-17-ethynyl-3-methoxy-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C#CC1=CC[C@H]2[C@@H]3CC=C4C=C(OC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H28O/c1-5-15-7-9-19-18-8-6-16-14-17(23-4)10-12-22(16,3)20(18)11-13-21(15,19)2/h1,6-7,14,18-20H,8-13H2,2-4H3/t18-,19-,20-,21+,22-/m0/s1 |
| InChIKey | OMTBYGRPGUOBTQ-KGWSWXIGSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|