C22H32O3 — CID 121337623
(10R,11S,13S)-3,10,13-trimethylspiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-11-ol (PubChem CID 121337623) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (10R,11S,13S)-3,10,13-trimethylspiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-11-ol.
| Compound Name | (10R,11S,13S)-3,10,13-trimethylspiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-11-ol |
|---|---|
| PubChem CID | 121337623 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (10R,11S,13S)-3,10,13-trimethylspiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-11-ol |
| SMILES | CC1=CC2=CCC3C(C(O)C[C@@]4(C)C3CCC43OCCO3)[C@@]2(C)CC1 |
| InChI | InChI=1S/C22H32O3/c1-14-6-8-20(2)15(12-14)4-5-16-17-7-9-22(24-10-11-25-22)21(17,3)13-18(23)19(16)20/h4,12,16-19,23H,5-11,13H2,1-3H3/t16?,17?,18?,19?,20-,21-/m0/s1 |
| InChIKey | JFOHPDAHOKTWNU-AYSFWYFTSA-N |
| XLogP | 4.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |