C23H34O3 — CID 124912186
(8S,9R,10S,13R,14R)-4,4,10,13-tetramethylspiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-one (PubChem CID 124912186) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (8S,9R,10S,13R,14R)-4,4,10,13-tetramethylspiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-one.
| Compound Name | (8S,9R,10S,13R,14R)-4,4,10,13-tetramethylspiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-one |
|---|---|
| PubChem CID | 124912186 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (8S,9R,10S,13R,14R)-4,4,10,13-tetramethylspiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-one |
| SMILES | CC1(C)C(=O)CC[C@]2(C)C1=CC[C@H]1[C@H]2CC[C@]2(C)[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C23H34O3/c1-20(2)18-6-5-15-16(21(18,3)10-9-19(20)24)7-11-22(4)17(15)8-12-23(22)25-13-14-26-23/h6,15-17H,5,7-14H2,1-4H3/t15-,16+,17+,21-,22+/m0/s1 |
| InChIKey | WAFJRNODYIQPFV-YGLRMMQHSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|