C21H32O — CID 124912176
(8R,9R,10R,13R,14R)-4,4,10,13-tetramethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 124912176) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is (8R,9R,10R,13R,14R)-4,4,10,13-tetramethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10R,13R,14R)-4,4,10,13-tetramethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 124912176 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (8R,9R,10R,13R,14R)-4,4,10,13-tetramethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1(C)C(=O)CC[C@@]2(C)C1=CC[C@@H]1[C@H]3CCC[C@]3(C)CC[C@H]12 |
| InChI | InChI=1S/C21H32O/c1-19(2)17-8-7-14-15-6-5-11-20(15,3)12-9-16(14)21(17,4)13-10-18(19)22/h8,14-16H,5-7,9-13H2,1-4H3/t14-,15-,16-,20-,21-/m1/s1 |
| InChIKey | UIMCFPFFKWDMST-AZCRCTTESA-N |
| XLogP | 5.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|