C20H28OS — CID 18645228
(10R,13S)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carbothioic S-acid (PubChem CID 18645228) has the molecular formula C20H28OS and a molecular weight of 316.51 g/mol. Its IUPAC name is (10R,13S)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carbothioic S-acid.
| Compound Name | (10R,13S)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carbothioic S-acid |
|---|---|
| PubChem CID | 18645228 |
| Molecular Formula | C20H28OS |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (10R,13S)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carbothioic S-acid |
| SMILES | C[C@@]12CCCC1C1CC=C3C=C(C(=O)S)CC[C@]3(C)C1CC2 |
| InChI | InChI=1S/C20H28OS/c1-19-9-3-4-16(19)15-6-5-14-12-13(18(21)22)7-11-20(14,2)17(15)8-10-19/h5,12,15-17H,3-4,6-11H2,1-2H3,(H,21,22)/t15?,16?,17?,19-,20-/m0/s1 |
| InChIKey | OPTYJENMZTULCV-GTSVPISWSA-N |
| XLogP | 5.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|