C20H26O2 — CID 22842444
(8S,9S,10R,13S,14S)-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3-carboxylic acid (PubChem CID 22842444) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3-carboxylic acid.
| Compound Name | (8S,9S,10R,13S,14S)-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3-carboxylic acid |
|---|---|
| PubChem CID | 22842444 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (8S,9S,10R,13S,14S)-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3-carboxylic acid |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC=C3C=C(C(=O)O)C=C[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C20H26O2/c1-19-9-3-4-16(19)15-6-5-14-12-13(18(21)22)7-11-20(14,2)17(15)8-10-19/h5,7,11-12,15-17H,3-4,6,8-10H2,1-2H3,(H,21,22)/t15-,16-,17-,19-,20-/m0/s1 |
| InChIKey | CPUURZBCPFRZAV-TXTPUJOMSA-N |
| XLogP | 4.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |