C27H42N2 — CID 141209476
1-[(8S,9S,10R,13S,14S)-10,13-dimethyl-1-pyrrolidin-1-yl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]pyrrolidine (PubChem CID 141209476) has the molecular formula C27H42N2 and a molecular weight of 394.65 g/mol. Its IUPAC name is 1-[(8S,9S,10R,13S,14S)-10,13-dimethyl-1-pyrrolidin-1-yl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]pyrrolidine.
| Compound Name | 1-[(8S,9S,10R,13S,14S)-10,13-dimethyl-1-pyrrolidin-1-yl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]pyrrolidine |
|---|---|
| PubChem CID | 141209476 |
| Molecular Formula | C27H42N2 |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | 1-[(8S,9S,10R,13S,14S)-10,13-dimethyl-1-pyrrolidin-1-yl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]pyrrolidine |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC=C3C=C(N4CCCC4)CC(N4CCCC4)[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C27H42N2/c1-26-12-7-8-23(26)22-10-9-20-18-21(28-14-3-4-15-28)19-25(29-16-5-6-17-29)27(20,2)24(22)11-13-26/h9,18,22-25H,3-8,10-17,19H2,1-2H3/t22-,23-,24-,25?,26-,27-/m0/s1 |
| InChIKey | TYAKIXIUVJFTJZ-BLBKDVNQSA-N |
| XLogP | 6.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |