C25H36O2 — CID 67856638
(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-pentyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3-carboxylic acid (PubChem CID 67856638) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-pentyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3-carboxylic acid.
| Compound Name | (8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-pentyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3-carboxylic acid |
|---|---|
| PubChem CID | 67856638 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-pentyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3-carboxylic acid |
| SMILES | CCCCC[C@@H]1CC[C@H]2[C@@H]3CC=C4C=C(C(=O)O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H36O2/c1-4-5-6-7-18-9-11-21-20-10-8-19-16-17(23(26)27)12-14-25(19,3)22(20)13-15-24(18,21)2/h8,12,14,16,18,20-22H,4-7,9-11,13,15H2,1-3H3,(H,26,27)/t18-,20+,21+,22+,24-,25+/m1/s1 |
| InChIKey | WBIZZVLVYZNTCZ-MUOFFRQRSA-N |
| XLogP | 6.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|