C32H51ClO2 — CID 129440458
[(3S,8R,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-chloro-2-methylbut-2-enoate (PubChem CID 129440458) has the molecular formula C32H51ClO2 and a molecular weight of 503.21 g/mol. Its IUPAC name is [(3S,8R,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-chloro-2-methylbut-2-enoate.
| Compound Name | [(3S,8R,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-chloro-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 129440458 |
| Molecular Formula | C32H51ClO2 |
| Molecular Weight | 503.21 g/mol |
| Exact Mass | 502.36 |
| IUPAC Name | [(3S,8R,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-chloro-2-methylbut-2-enoate |
| SMILES | CCCCCCCC[C@@H]1CC[C@@H]2[C@H]3CC=C4C[C@@H](OC(=O)/C(C)=C(\C)Cl)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C32H51ClO2/c1-6-7-8-9-10-11-12-24-14-16-28-27-15-13-25-21-26(35-30(34)22(2)23(3)33)17-19-32(25,5)29(27)18-20-31(24,28)4/h13,24,26-29H,6-12,14-21H2,1-5H3/b23-22+/t24-,26+,27-,28-,29-,31-,32+/m1/s1 |
| InChIKey | STLCUNPCLGNSSN-LVZKJFOZSA-N |
| XLogP | 9.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.21 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|