C38H60O2 — CID 124904167
[(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] adamantane-1-carboxylate (PubChem CID 124904167) has the molecular formula C38H60O2 and a molecular weight of 548.90 g/mol. Its IUPAC name is [(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] adamantane-1-carboxylate.
| Compound Name | [(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 124904167 |
| Molecular Formula | C38H60O2 |
| Molecular Weight | 548.90 g/mol |
| Exact Mass | 548.46 |
| IUPAC Name | [(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] adamantane-1-carboxylate |
| SMILES | CCCCCCCC[C@@H]1CC[C@@H]2[C@@H]3CC=C4C[C@@H](OC(=O)C56CC7CC(CC(C7)C5)C6)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C38H60O2/c1-4-5-6-7-8-9-10-29-12-14-33-32-13-11-30-22-31(15-17-37(30,3)34(32)16-18-36(29,33)2)40-35(39)38-23-26-19-27(24-38)21-28(20-26)25-38/h11,26-29,31-34H,4-10,12-25H2,1-3H3/t26?,27?,28?,29-,31+,32+,33-,34-,36-,37+,38?/m1/s1 |
| InChIKey | YNHQSVAFFONAPB-GRBIBBJISA-N |
| XLogP | 10.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.90 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|