C35H58O2 — CID 163044188
[(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-cyclohexylacetate (PubChem CID 163044188) has the molecular formula C35H58O2 and a molecular weight of 510.85 g/mol. Its IUPAC name is [(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-cyclohexylacetate.
| Compound Name | [(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-cyclohexylacetate |
|---|---|
| PubChem CID | 163044188 |
| Molecular Formula | C35H58O2 |
| Molecular Weight | 510.85 g/mol |
| Exact Mass | 510.44 |
| IUPAC Name | [(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-cyclohexylacetate |
| SMILES | CCCCCCCC[C@H]1CC[C@@H]2[C@H]3CC=C4C[C@@H](OC(=O)CC5CCCCC5)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C35H58O2/c1-4-5-6-7-8-12-15-27-17-19-31-30-18-16-28-25-29(37-33(36)24-26-13-10-9-11-14-26)20-22-35(28,3)32(30)21-23-34(27,31)2/h16,26-27,29-32H,4-15,17-25H2,1-3H3/t27-,29-,30+,31+,32+,34+,35-/m0/s1 |
| InChIKey | IHAKLGIJTRDLFE-WEMLGVLTSA-N |
| XLogP | 10.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.85 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|