C31H52O2 — CID 144759363
[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pentanoate (PubChem CID 144759363) has the molecular formula C31H52O2 and a molecular weight of 456.76 g/mol. Its IUPAC name is [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pentanoate.
| Compound Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pentanoate |
|---|---|
| PubChem CID | 144759363 |
| Molecular Formula | C31H52O2 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.40 |
| IUPAC Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pentanoate |
| SMILES | CCCCC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(CCCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C31H52O2/c1-6-7-12-29(32)33-25-17-19-31(5)24(21-25)13-15-26-27-16-14-23(11-9-8-10-22(2)3)30(27,4)20-18-28(26)31/h13,22-23,25-28H,6-12,14-21H2,1-5H3 |
| InChIKey | ZBVOANYAUQVMIY-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|