C32H57NO2 — CID 144695111
[(8S,10R,13R,17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-(dimethylamino)acetate;ethane (PubChem CID 144695111) has the molecular formula C32H57NO2 and a molecular weight of 487.81 g/mol. Its IUPAC name is [(8S,10R,13R,17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-(dimethylamino)acetate;ethane.
| Compound Name | [(8S,10R,13R,17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-(dimethylamino)acetate;ethane |
|---|---|
| PubChem CID | 144695111 |
| Molecular Formula | C32H57NO2 |
| Molecular Weight | 487.81 g/mol |
| Exact Mass | 487.44 |
| IUPAC Name | [(8S,10R,13R,17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-(dimethylamino)acetate;ethane |
| SMILES | CC.CC(C)CCCC[C@H]1CCC2[C@@H]3CC=C4CC(OC(=O)CN(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H51NO2.C2H6/c1-21(2)9-7-8-10-22-12-14-26-25-13-11-23-19-24(33-28(32)20-31(5)6)15-17-30(23,4)27(25)16-18-29(22,26)3;1-2/h11,21-22,24-27H,7-10,12-20H2,1-6H3;1-2H3/t22-,24?,25-,26?,27?,29+,30-;/m0./s1 |
| InChIKey | XFPXSHOWAZZFHD-UGWITFJSSA-N |
| XLogP | 8.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.81 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|