C42H75N3O3S — CID 170111322
[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[3-aminobutyl-(8-amino-8-sulfanyloctyl)amino]-4-oxobutanoate (PubChem CID 170111322) has the molecular formula C42H75N3O3S and a molecular weight of 702.15 g/mol. Its IUPAC name is [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[3-aminobutyl-(8-amino-8-sulfanyloctyl)amino]-4-oxobutanoate.
| Compound Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[3-aminobutyl-(8-amino-8-sulfanyloctyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 170111322 |
| Molecular Formula | C42H75N3O3S |
| Molecular Weight | 702.15 g/mol |
| Exact Mass | 701.55 |
| IUPAC Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[3-aminobutyl-(8-amino-8-sulfanyloctyl)amino]-4-oxobutanoate |
| SMILES | CC(C)CCCCC1CCC2C3CC=C4CC(OC(=O)CCC(=O)N(CCCCCCCC(N)S)CCC(C)N)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C42H75N3O3S/c1-30(2)13-10-11-14-32-17-19-36-35-18-16-33-29-34(22-25-42(33,5)37(35)23-26-41(32,36)4)48-40(47)21-20-39(46)45(28-24-31(3)43)27-12-8-6-7-9-15-38(44)49/h16,30-32,34-38,49H,6-15,17-29,43-44H2,1-5H3 |
| InChIKey | QVRYTURSVYSELQ-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.15 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|