C41H77N3O2 — CID 169146317
[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis(6-aminohexyl)carbamate;ethane (PubChem CID 169146317) has the molecular formula C41H77N3O2 and a molecular weight of 644.09 g/mol. Its IUPAC name is [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis(6-aminohexyl)carbamate;ethane.
| Compound Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis(6-aminohexyl)carbamate;ethane |
|---|---|
| PubChem CID | 169146317 |
| Molecular Formula | C41H77N3O2 |
| Molecular Weight | 644.09 g/mol |
| Exact Mass | 643.60 |
| IUPAC Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis(6-aminohexyl)carbamate;ethane |
| SMILES | CC.CC(C)CCCCC1CCC2C3CC=C4CC(OC(=O)N(CCCCCCN)CCCCCCN)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C39H71N3O2.C2H6/c1-30(2)15-9-10-16-31-18-20-35-34-19-17-32-29-33(21-23-39(32,4)36(34)22-24-38(31,35)3)44-37(43)42(27-13-7-5-11-25-40)28-14-8-6-12-26-41;1-2/h17,30-31,33-36H,5-16,18-29,40-41H2,1-4H3;1-2H3 |
| InChIKey | PYQPCZWSLOGRGL-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.09 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|