C29H48O3 — CID 142431942
3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propanoic acid (PubChem CID 142431942) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is 3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propanoic acid.
| Compound Name | 3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 142431942 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | 3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propanoic acid |
| SMILES | CC(C)CCCCC1CCC2C3CC=C4CC(OCCC(=O)O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C29H48O3/c1-20(2)7-5-6-8-21-10-12-25-24-11-9-22-19-23(32-18-15-27(30)31)13-16-29(22,4)26(24)14-17-28(21,25)3/h9,20-21,23-26H,5-8,10-19H2,1-4H3,(H,30,31) |
| InChIKey | FBHPKQXOFKYUER-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|