C26H43NaO4S — CID 163199507
sodium [(3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate (PubChem CID 163199507) has the molecular formula C26H43NaO4S and a molecular weight of 474.68 g/mol. Its IUPAC name is sodium [(3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate.
| Compound Name | sodium [(3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate |
|---|---|
| PubChem CID | 163199507 |
| Molecular Formula | C26H43NaO4S |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | sodium [(3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate |
| SMILES | CC(C)CCCC[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OS(=O)(=O)[O-])CC[C@]4(C)[C@H]3CC[C@]12C.[Na+] |
| InChI | InChI=1S/C26H44O4S.Na/c1-18(2)7-5-6-8-19-10-12-23-22-11-9-20-17-21(30-31(27,28)29)13-15-26(20,4)24(22)14-16-25(19,23)3;/h9,18-19,21-24H,5-8,10-17H2,1-4H3,(H,27,28,29);/q;+1/p-1/t19-,21-,22-,23-,24-,25+,26-;/m0./s1 |
| InChIKey | VFRNVIMCEGUSQQ-DRBNJXQWSA-M |
| XLogP | 3.63 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|