C27H46 — CID 144759476
(3S)-3,10,13-trimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 144759476) has the molecular formula C27H46 and a molecular weight of 370.67 g/mol. Its IUPAC name is (3S)-3,10,13-trimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S)-3,10,13-trimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 144759476 |
| Molecular Formula | C27H46 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 370.36 |
| IUPAC Name | (3S)-3,10,13-trimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)CCCCC1CCC2C3CC=C4C[C@@H](C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C27H46/c1-19(2)8-6-7-9-21-11-13-24-23-12-10-22-18-20(3)14-16-27(22,5)25(23)15-17-26(21,24)4/h10,19-21,23-25H,6-9,11-18H2,1-5H3/t20-,21?,23?,24?,25?,26?,27?/m0/s1 |
| InChIKey | BCRFQMYKXQIPOS-SUAWPXJKSA-N |
| XLogP | 8.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|