C32H60 — CID 154673167
ethane;(8S)-3-ethyl-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 154673167) has the molecular formula C32H60 and a molecular weight of 444.83 g/mol. Its IUPAC name is ethane;(8S)-3-ethyl-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | ethane;(8S)-3-ethyl-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 154673167 |
| Molecular Formula | C32H60 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.47 |
| IUPAC Name | ethane;(8S)-3-ethyl-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC.CC.CCC1CCC2(C)C(=CC[C@@H]3C2CCC2(C)C(CCCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C28H48.2C2H6/c1-6-21-15-17-28(5)23(19-21)11-13-24-25-14-12-22(10-8-7-9-20(2)3)27(25,4)18-16-26(24)28;2*1-2/h11,20-22,24-26H,6-10,12-19H2,1-5H3;2*1-2H3/t21?,22?,24-,25?,26?,27?,28?;;/m0../s1 |
| InChIKey | GADXNJTVZMNSOS-BOZQQBDOSA-N |
| XLogP | 10.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|