C35H62O2 — CID 123937940
1-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]nonan-1-ol (PubChem CID 123937940) has the molecular formula C35H62O2 and a molecular weight of 514.88 g/mol. Its IUPAC name is 1-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]nonan-1-ol.
| Compound Name | 1-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]nonan-1-ol |
|---|---|
| PubChem CID | 123937940 |
| Molecular Formula | C35H62O2 |
| Molecular Weight | 514.88 g/mol |
| Exact Mass | 514.47 |
| IUPAC Name | 1-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]nonan-1-ol |
| SMILES | CCCCCCCCC(O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(CCCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C35H62O2/c1-6-7-8-9-10-11-16-33(36)37-29-21-23-35(5)28(25-29)17-19-30-31-20-18-27(15-13-12-14-26(2)3)34(31,4)24-22-32(30)35/h17,26-27,29-33,36H,6-16,18-25H2,1-5H3 |
| InChIKey | PNTPMBSVSMNPKN-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.88 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|