C43H81NO3 — CID 144911718
3-butoxy-2-(dimethylamino)propan-1-ol;10,13-dimethyl-17-(5-methylhexyl)-3-octoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 144911718) has the molecular formula C43H81NO3 and a molecular weight of 660.12 g/mol. Its IUPAC name is 3-butoxy-2-(dimethylamino)propan-1-ol;10,13-dimethyl-17-(5-methylhexyl)-3-octoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 3-butoxy-2-(dimethylamino)propan-1-ol;10,13-dimethyl-17-(5-methylhexyl)-3-octoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 144911718 |
| Molecular Formula | C43H81NO3 |
| Molecular Weight | 660.12 g/mol |
| Exact Mass | 659.62 |
| IUPAC Name | 3-butoxy-2-(dimethylamino)propan-1-ol;10,13-dimethyl-17-(5-methylhexyl)-3-octoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCCCCCCCOC1CCC2(C)C(=CCC3C2CCC2(C)C(CCCCC(C)C)CCC32)C1.CCCCOCC(CO)N(C)C |
| InChI | InChI=1S/C34H60O.C9H21NO2/c1-6-7-8-9-10-13-24-35-29-20-22-34(5)28(25-29)16-18-30-31-19-17-27(15-12-11-14-26(2)3)33(31,4)23-21-32(30)34;1-4-5-6-12-8-9(7-11)10(2)3/h16,26-27,29-32H,6-15,17-25H2,1-5H3;9,11H,4-8H2,1-3H3 |
| InChIKey | LHCXSKZLMGWIOU-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.12 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|