C45H81NO3 — CID 144911731
(2R)-1-heptoxy-N,N-dimethyl-3-[7-[[(2S,15S)-12-methyl-6-(4-methylpentyl)-15-pentacyclo[9.8.0.02,8.05,8.012,17]nonadec-17-enyl]oxy]heptoxy]propan-2-amine (PubChem CID 144911731) has the molecular formula C45H81NO3 and a molecular weight of 684.15 g/mol. Its IUPAC name is (2R)-1-heptoxy-N,N-dimethyl-3-[7-[[(2S,15S)-12-methyl-6-(4-methylpentyl)-15-pentacyclo[9.8.0.02,8.05,8.012,17]nonadec-17-enyl]oxy]heptoxy]propan-2-amine.
| Compound Name | (2R)-1-heptoxy-N,N-dimethyl-3-[7-[[(2S,15S)-12-methyl-6-(4-methylpentyl)-15-pentacyclo[9.8.0.02,8.05,8.012,17]nonadec-17-enyl]oxy]heptoxy]propan-2-amine |
|---|---|
| PubChem CID | 144911731 |
| Molecular Formula | C45H81NO3 |
| Molecular Weight | 684.15 g/mol |
| Exact Mass | 683.62 |
| IUPAC Name | (2R)-1-heptoxy-N,N-dimethyl-3-[7-[[(2S,15S)-12-methyl-6-(4-methylpentyl)-15-pentacyclo[9.8.0.02,8.05,8.012,17]nonadec-17-enyl]oxy]heptoxy]propan-2-amine |
| SMILES | CCCCCCCOC[C@H](COCCCCCCCO[C@H]1CCC2(C)C(=CCC3C2CCC24CC(CCCC(C)C)C2CC[C@@H]34)C1)N(C)C |
| InChI | InChI=1S/C45H81NO3/c1-7-8-9-11-14-28-47-33-38(46(5)6)34-48-29-15-12-10-13-16-30-49-39-24-26-44(4)37(31-39)20-21-40-42(44)25-27-45-32-36(19-17-18-35(2)3)41(45)22-23-43(40)45/h20,35-36,38-43H,7-19,21-34H2,1-6H3/t36?,38-,39+,40?,41?,42?,43+,44?,45?/m1/s1 |
| InChIKey | DGBSHPFGZMOPGD-ILUXUWBSSA-N |
| XLogP | 11.66 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.15 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|