C42H77NO3 — CID 75596398
1-[4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]butoxy]-3-octoxypropan-2-amine (PubChem CID 75596398) has the molecular formula C42H77NO3 and a molecular weight of 644.08 g/mol. Its IUPAC name is 1-[4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]butoxy]-3-octoxypropan-2-amine.
| Compound Name | 1-[4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]butoxy]-3-octoxypropan-2-amine |
|---|---|
| PubChem CID | 75596398 |
| Molecular Formula | C42H77NO3 |
| Molecular Weight | 644.08 g/mol |
| Exact Mass | 643.59 |
| IUPAC Name | 1-[4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]butoxy]-3-octoxypropan-2-amine |
| SMILES | CCCCCCCCOCC(N)COCCCCOC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C42H77NO3/c1-7-8-9-10-11-12-26-44-30-35(43)31-45-27-13-14-28-46-36-22-24-41(5)34(29-36)18-19-37-39-21-20-38(33(4)17-15-16-32(2)3)42(39,6)25-23-40(37)41/h18,32-33,35-40H,7-17,19-31,43H2,1-6H3 |
| InChIKey | YKZQHRFOXFSSKS-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.08 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|