C38H68O5 — CID 135251296
(3S,9S,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 135251296) has the molecular formula C38H68O5 and a molecular weight of 604.96 g/mol. Its IUPAC name is (3S,9S,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,9S,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 135251296 |
| Molecular Formula | C38H68O5 |
| Molecular Weight | 604.96 g/mol |
| Exact Mass | 604.51 |
| IUPAC Name | (3S,9S,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCCOCCOCCOCCOCCO[C@H]1CCC2(C)C(=CCC3[C@@H]2CCC2(C)C([C@H](C)CCCC(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C38H68O5/c1-7-19-39-20-21-40-22-23-41-24-25-42-26-27-43-32-15-17-37(5)31(28-32)11-12-33-35-14-13-34(30(4)10-8-9-29(2)3)38(35,6)18-16-36(33)37/h11,29-30,32-36H,7-10,12-28H2,1-6H3/t30-,32+,33?,34?,35+,36+,37?,38?/m1/s1 |
| InChIKey | SKINPDDNLRCZMH-SFXARDBYSA-N |
| XLogP | 8.89 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.96 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|