C32H56O5S — CID 59753236
2-[2-[[(3S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy]ethyl methanesulfonate (PubChem CID 59753236) has the molecular formula C32H56O5S and a molecular weight of 552.86 g/mol. Its IUPAC name is 2-[2-[[(3S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[[(3S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 59753236 |
| Molecular Formula | C32H56O5S |
| Molecular Weight | 552.86 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | 2-[2-[[(3S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy]ethyl methanesulfonate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4C[C@@H](OCCOCCOS(C)(=O)=O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C32H56O5S/c1-23(2)8-7-9-24(3)28-12-13-29-27-11-10-25-22-26(36-20-18-35-19-21-37-38(6,33)34)14-16-31(25,4)30(27)15-17-32(28,29)5/h10,23-24,26-30H,7-9,11-22H2,1-6H3/t24?,26-,27?,28?,29?,30?,31-,32+/m0/s1 |
| InChIKey | MPGVDBHXNHQRHA-AGFJMXOLSA-N |
| XLogP | 7.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.86 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|