C39H70O4 — CID 146397339
(3S,17R)-3-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 146397339) has the molecular formula C39H70O4 and a molecular weight of 602.99 g/mol. Its IUPAC name is (3S,17R)-3-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,17R)-3-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 146397339 |
| Molecular Formula | C39H70O4 |
| Molecular Weight | 602.99 g/mol |
| Exact Mass | 602.53 |
| IUPAC Name | (3S,17R)-3-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)CCCC(C)[C@H]1CCC2C3CC=C4C[C@@H](OCCOCCOCCOCCC(C)(C)C)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C39H70O4/c1-29(2)10-9-11-30(3)34-14-15-35-33-13-12-31-28-32(16-18-38(31,7)36(33)17-19-39(34,35)8)43-27-26-42-25-24-41-23-22-40-21-20-37(4,5)6/h12,29-30,32-36H,9-11,13-28H2,1-8H3/t30?,32-,33?,34+,35?,36?,38?,39?/m0/s1 |
| InChIKey | AOCYQKZTOLVCGD-RZBGDPTDSA-N |
| XLogP | 9.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.99 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|