C35H62O2 — CID 142411432
(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-(2-methyl-4-propoxybutan-2-yl)oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 142411432) has the molecular formula C35H62O2 and a molecular weight of 514.88 g/mol. Its IUPAC name is (3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-(2-methyl-4-propoxybutan-2-yl)oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-(2-methyl-4-propoxybutan-2-yl)oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 142411432 |
| Molecular Formula | C35H62O2 |
| Molecular Weight | 514.88 g/mol |
| Exact Mass | 514.47 |
| IUPAC Name | (3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-(2-methyl-4-propoxybutan-2-yl)oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCCOCCC(C)(C)O[C@H]1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C35H62O2/c1-9-22-36-23-21-33(5,6)37-28-17-19-34(7)27(24-28)13-14-29-31-16-15-30(26(4)12-10-11-25(2)3)35(31,8)20-18-32(29)34/h13,25-26,28-32H,9-12,14-24H2,1-8H3/t26-,28+,29?,30-,31?,32?,34+,35-/m1/s1 |
| InChIKey | YUGUBYWFXSOUBX-VVADNRIUSA-N |
| XLogP | 10.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.88 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|