C31H54O3 — CID 146367603
2-[2-[[(10S,13S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy]ethanol (PubChem CID 146367603) has the molecular formula C31H54O3 and a molecular weight of 474.77 g/mol. Its IUPAC name is 2-[2-[[(10S,13S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy]ethanol.
| Compound Name | 2-[2-[[(10S,13S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 146367603 |
| Molecular Formula | C31H54O3 |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 474.41 |
| IUPAC Name | 2-[2-[[(10S,13S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy]ethanol |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OCCOCCO)CC[C@@]4(C)C3CC[C@@]12C |
| InChI | InChI=1S/C31H54O3/c1-22(2)7-6-8-23(3)27-11-12-28-26-10-9-24-21-25(34-20-19-33-18-17-32)13-15-30(24,4)29(26)14-16-31(27,28)5/h9,22-23,25-29,32H,6-8,10-21H2,1-5H3/t23?,25?,26?,27?,28?,29?,30-,31+/m1/s1 |
| InChIKey | QODKZBLJMHZMAI-JLBGWWKCSA-N |
| XLogP | 7.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|