C36H64O4S — CID 58434801
8-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]octyl methanesulfonate (PubChem CID 58434801) has the molecular formula C36H64O4S and a molecular weight of 592.97 g/mol. Its IUPAC name is 8-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]octyl methanesulfonate.
| Compound Name | 8-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]octyl methanesulfonate |
|---|---|
| PubChem CID | 58434801 |
| Molecular Formula | C36H64O4S |
| Molecular Weight | 592.97 g/mol |
| Exact Mass | 592.45 |
| IUPAC Name | 8-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]octyl methanesulfonate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OCCCCCCCCOS(C)(=O)=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C36H64O4S/c1-27(2)14-13-15-28(3)32-18-19-33-31-17-16-29-26-30(20-22-35(29,4)34(31)21-23-36(32,33)5)39-24-11-9-7-8-10-12-25-40-41(6,37)38/h16,27-28,30-34H,7-15,17-26H2,1-6H3/t28-,30+,31+,32-,33+,34+,35+,36-/m1/s1 |
| InChIKey | MCLYCWQOLQZODW-ZDEQVQIQSA-N |
| XLogP | 9.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.97 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|