C35H62OS — CID 129026960
8-[[(3S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]octane-1-thiol (PubChem CID 129026960) has the molecular formula C35H62OS and a molecular weight of 530.95 g/mol. Its IUPAC name is 8-[[(3S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]octane-1-thiol.
| Compound Name | 8-[[(3S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]octane-1-thiol |
|---|---|
| PubChem CID | 129026960 |
| Molecular Formula | C35H62OS |
| Molecular Weight | 530.95 g/mol |
| Exact Mass | 530.45 |
| IUPAC Name | 8-[[(3S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]octane-1-thiol |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4C[C@@H](OCCCCCCCCS)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C35H62OS/c1-26(2)13-12-14-27(3)31-17-18-32-30-16-15-28-25-29(36-23-10-8-6-7-9-11-24-37)19-21-34(28,4)33(30)20-22-35(31,32)5/h15,26-27,29-33,37H,6-14,16-25H2,1-5H3/t27?,29-,30?,31?,32?,33?,34?,35?/m0/s1 |
| InChIKey | YASFRSKTCKCRGK-IULXZOPSSA-N |
| XLogP | 10.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.95 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|