C29H49BrO — CID 68863593
(8S,9S,10R,13R,14S,17R)-3-(2-bromoethoxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 68863593) has the molecular formula C29H49BrO and a molecular weight of 493.61 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17R)-3-(2-bromoethoxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,10R,13R,14S,17R)-3-(2-bromoethoxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 68863593 |
| Molecular Formula | C29H49BrO |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | (8S,9S,10R,13R,14S,17R)-3-(2-bromoethoxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(OCCBr)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H49BrO/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-22-19-23(31-18-17-30)13-15-28(22,4)27(24)14-16-29(25,26)5/h9,20-21,23-27H,6-8,10-19H2,1-5H3/t21-,23?,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | COHQLQCPBJOPLR-KZSQEHGRSA-N |
| XLogP | 8.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|