C31H52O — CID 101409884
(3S,8S,9S,10R,13R,14S,17R)-3-(cyclopropylmethoxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 101409884) has the molecular formula C31H52O and a molecular weight of 440.76 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-3-(cyclopropylmethoxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-3-(cyclopropylmethoxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 101409884 |
| Molecular Formula | C31H52O |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.40 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-3-(cyclopropylmethoxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OCC5CC5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H52O/c1-21(2)7-6-8-22(3)27-13-14-28-26-12-11-24-19-25(32-20-23-9-10-23)15-17-30(24,4)29(26)16-18-31(27,28)5/h11,21-23,25-29H,6-10,12-20H2,1-5H3/t22-,25+,26+,27-,28+,29+,30+,31-/m1/s1 |
| InChIKey | QFEUSPZGBCCCSB-SBBRIPHWSA-N |
| XLogP | 8.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|