C29H49BO — CID 123650705
CID 123650705 (PubChem CID 123650705) has the molecular formula C29H49BO and a molecular weight of 424.52 g/mol.
| Compound Name | CID 123650705 |
|---|---|
| PubChem CID | 123650705 |
| Molecular Formula | C29H49BO |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.39 |
| IUPAC Name | — |
| SMILES | [B]CCOC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C29H49BO/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-22-19-23(31-18-17-30)13-15-28(22,4)27(24)14-16-29(25,26)5/h9,20-21,23-27H,6-8,10-19H2,1-5H3 |
| InChIKey | IFBFENNRKZSYNW-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|