C26H43Na2O4P — CID 145230461
disodium;[(17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phosphate (PubChem CID 145230461) has the molecular formula C26H43Na2O4P and a molecular weight of 496.58 g/mol. Its IUPAC name is disodium;[(17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phosphate.
| Compound Name | disodium;[(17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phosphate |
|---|---|
| PubChem CID | 145230461 |
| Molecular Formula | C26H43Na2O4P |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | disodium;[(17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phosphate |
| SMILES | CC(C)CCCC[C@H]1CCC2C3CC=C4CC(OP(=O)([O-])[O-])CCC4(C)C3CCC21C.[Na+].[Na+] |
| InChI | InChI=1S/C26H45O4P.2Na/c1-18(2)7-5-6-8-19-10-12-23-22-11-9-20-17-21(30-31(27,28)29)13-15-26(20,4)24(22)14-16-25(19,23)3;;/h9,18-19,21-24H,5-8,10-17H2,1-4H3,(H2,27,28,29);;/q;2*+1/p-2/t19-,21?,22?,23?,24?,25?,26?;;/m0../s1 |
| InChIKey | HKCLWTGTFYMINP-PRDFRYFLSA-L |
| XLogP | 0.00 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|