C31H56NO3P — CID 59929776
2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-methylphosphoryl]oxy-N,N-dimethylethanamine (PubChem CID 59929776) has the molecular formula C31H56NO3P and a molecular weight of 521.77 g/mol. Its IUPAC name is 2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-methylphosphoryl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-methylphosphoryl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 59929776 |
| Molecular Formula | C31H56NO3P |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.40 |
| IUPAC Name | 2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-methylphosphoryl]oxy-N,N-dimethylethanamine |
| SMILES | CC(C)CCCCC1CCC2C3CC=C4CC(OP(C)(=O)OCCN(C)C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C31H56NO3P/c1-23(2)10-8-9-11-24-13-15-28-27-14-12-25-22-26(35-36(7,33)34-21-20-32(5)6)16-18-31(25,4)29(27)17-19-30(24,28)3/h12,23-24,26-29H,8-11,13-22H2,1-7H3 |
| InChIKey | KHDBJQFOTOHBKY-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|