C27H45Li2O4P — CID 146503770
dilithium;[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phosphate (PubChem CID 146503770) has the molecular formula C27H45Li2O4P and a molecular weight of 478.51 g/mol. Its IUPAC name is dilithium;[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phosphate.
| Compound Name | dilithium;[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phosphate |
|---|---|
| PubChem CID | 146503770 |
| Molecular Formula | C27H45Li2O4P |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | dilithium;[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phosphate |
| SMILES | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OP(=O)([O-])[O-])CC[C@]4(C)[C@H]3CC[C@]12C.[Li+].[Li+] |
| InChI | InChI=1S/C27H47O4P.2Li/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(31-32(28,29)30)13-15-26(20,4)25(22)14-16-27(23,24)5;;/h9,18-19,21-25H,6-8,10-17H2,1-5H3,(H2,28,29,30);;/q;2*+1/p-2/t19?,21-,22-,23+,24-,25-,26-,27+;;/m0../s1 |
| InChIKey | IQAKFPQPQQRZTG-QTIHWTQWSA-L |
| XLogP | 0.25 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|