C28H48ClO2P — CID 160702940
(10R,13R)-3-[chloro(methyl)phosphoryl]oxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 160702940) has the molecular formula C28H48ClO2P and a molecular weight of 483.12 g/mol. Its IUPAC name is (10R,13R)-3-[chloro(methyl)phosphoryl]oxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (10R,13R)-3-[chloro(methyl)phosphoryl]oxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 160702940 |
| Molecular Formula | C28H48ClO2P |
| Molecular Weight | 483.12 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | (10R,13R)-3-[chloro(methyl)phosphoryl]oxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OP(C)(=O)Cl)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C28H48ClO2P/c1-19(2)8-7-9-20(3)24-12-13-25-23-11-10-21-18-22(31-32(6,29)30)14-16-27(21,4)26(23)15-17-28(24,25)5/h10,19-20,22-26H,7-9,11-18H2,1-6H3/t20?,22?,23?,24?,25?,26?,27-,28+,32?/m0/s1 |
| InChIKey | RQVXAEUECGTPGW-OSIACAAUSA-N |
| XLogP | 9.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.12 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|