C31H55O4P — CID 164685611
[(3R,8S,9S,10S,13R,14S,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] diethyl phosphate (PubChem CID 164685611) has the molecular formula C31H55O4P and a molecular weight of 522.75 g/mol. Its IUPAC name is [(3R,8S,9S,10S,13R,14S,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] diethyl phosphate.
| Compound Name | [(3R,8S,9S,10S,13R,14S,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] diethyl phosphate |
|---|---|
| PubChem CID | 164685611 |
| Molecular Formula | C31H55O4P |
| Molecular Weight | 522.75 g/mol |
| Exact Mass | 522.38 |
| IUPAC Name | [(3R,8S,9S,10S,13R,14S,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O[C@@H]1CC[C@]2(C)C(=CC[C@H]3[C@@H]4CC[C@@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C31H55O4P/c1-8-33-36(32,34-9-2)35-25-17-19-30(6)24(21-25)13-14-26-28-16-15-27(23(5)12-10-11-22(3)4)31(28,7)20-18-29(26)30/h13,22-23,25-29H,8-12,14-21H2,1-7H3/t23-,25-,26+,27+,28+,29+,30-,31-/m1/s1 |
| InChIKey | YEDCMYGQNDZTJH-WNJSRQDFSA-N |
| XLogP | 9.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.75 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|